Abstract:

Synthesis 79-24-3 is a complex chemical compound with a unique set of properties, making it a versatile material in various industrial applications. This article delves into the chemical composition of Synthesis 79-24-3, its physical properties, and its diverse applications across different industries.

synthesis 79-24-3

Introduction:

Synthesis 79-24-3, also known as 2-ethyl-1,3-hexanediol, is a synthetic compound that has been gaining attention in recent years due to its versatility and effectiveness in various applications. This colorless liquid has a characteristic sweet, fruity odor and is soluble in most organic solvents.

Chemical Composition:

The chemical formula for Synthesis 79-24-3 is C8H18O3. Its molecular weight is 170.21 g/mol, and its structural formula is CH3CH2CH2OH-CH2CH(CH3)COOH. The compound consists of a hydroxyl (-OH) group, a carboxyl (-COOH) group, and a branched alkyl chain (CH3CH2CH2) attached to the main carbon atom. This unique structure gives Synthesis 79-24-3 its distinct properties and applications.

Physical Properties:

Synthesis 79-24-3 has a density of 1.03 g/mL and a boiling point of 196-198°C at 0.1 mbar. It has a flash point of 72°C and a pour point of -25°C. The compound is stable under normal conditions but can be sensitive to light, heat, and oxidizing agents.

Applications:

Synthesis 79-24-3 has a wide range of applications across various industries, including:

1. Plastics and Polymers: Synthesis 79-24-3 is used as a plasticizer in the production of polyvinyl chloride (PVC) and other polymers. It enhances flexibility, durability, and resistance to heat and chemicals.

2. Lubricants: The compound's lubricating properties make it an effective additive in the production of lubricants, particularly in the automotive and industrial sectors.

3. Personal Care: Synthesis 79-24-3 is used in the production of personal care products such as lotions, creams, and shampoos due to its moisturizing and emollient properties.

4. Pharmaceuticals: The compound has been used in the development of certain pharmaceutical products, including anti-inflammatory and antimicrobial agents.

5. Food and Beverage: Synthesis 79-24-3 has been approved for use in food and beverage applications, specifically as a flavoring agent and a preservative.

Conclusion:

Synthesis 79-24-3 is a versatile compound with a unique set of chemical and physical properties, making it a valuable material in various industries. Its applications range from plastics and lubricants to personal care, pharmaceuticals, and food and beverage. As research continues to uncover the full potential of this compound, it is likely that Synthesis 79-24-3 will play an increasingly important role in shaping the future of science and technology.